ID | 1324 |
Name | Berberal |
Pubchem ID | 9424 |
KEGG ID | N/A |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antiparasitic |
Drug Like Properties | No |
Molecular Weight | 768.79 |
Exact mass | 768.198895 |
Molecular formula | C40H36N2O12S |
XlogP | N/A |
Topological Polar Surface Area | 162 |
H-Bond Donor | 0 |
H-Bond Acceptor | 12 |
Rotational Bond Count | 4 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[O-]S(=O)(=O)[O-] |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1325 |
Name | Berberal |
Pubchem ID | 9424 |
KEGG ID | N/A |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antifungal |
Drug Like Properties | No |
Molecular Weight | 768.79 |
Exact mass | 768.198895 |
Molecular formula | C40H36N2O12S |
XlogP | N/A |
Topological Polar Surface Area | 162 |
H-Bond Donor | 0 |
H-Bond Acceptor | 12 |
Rotational Bond Count | 4 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[O-]S(=O)(=O)[O-] |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1326 |
Name | Berberal |
Pubchem ID | 9424 |
KEGG ID | N/A |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antidiarrheal |
Drug Like Properties | No |
Molecular Weight | 768.79 |
Exact mass | 768.198895 |
Molecular formula | C40H36N2O12S |
XlogP | N/A |
Topological Polar Surface Area | 162 |
H-Bond Donor | 0 |
H-Bond Acceptor | 12 |
Rotational Bond Count | 4 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[O-]S(=O)(=O)[O-] |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1327 |
Name | Berberine |
Pubchem ID | 2353 |
KEGG ID | D06817 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antiparasitic |
Drug Like Properties | Yes |
Molecular Weight | 336.36 |
Exact mass | 336.123583 |
Molecular formula | C20H18NO4+ |
XlogP | 3.6 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1379 |
Name | Berberine |
Pubchem ID | 2353 |
KEGG ID | D06817 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antifungal |
Drug Like Properties | Yes |
Molecular Weight | 336.36 |
Exact mass | 336.123583 |
Molecular formula | C20H18NO4+ |
XlogP | 3.6 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1431 |
Name | Berberine |
Pubchem ID | 2353 |
KEGG ID | D06817 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antidiarrheal |
Drug Like Properties | Yes |
Molecular Weight | 336.36 |
Exact mass | 336.123583 |
Molecular formula | C20H18NO4+ |
XlogP | 3.6 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1483 |
Name | Berberine |
Pubchem ID | 23644195 |
KEGG ID | N/A |
Source | Hydrastis canadensis |
Type | Natural |
Function | Unknown |
Drug Like Properties | Yes |
Molecular Weight | 346.44 |
Exact mass | 346.201833 |
Molecular formula | C20H28NO4+ |
XlogP | 0.4 |
Topological Polar Surface Area | 39.9 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC1)CC3=[N+](C2)CCC4C3CC5C(C4)OCO5)OC |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1487 |
Name | Berberine chloride |
Pubchem ID | 12456 |
KEGG ID | C12679 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antiparasitic |
Drug Like Properties | No |
Molecular Weight | 371.81 |
Exact mass | 371.092436 |
Molecular formula | C20H18ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-] |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1488 |
Name | Berberine chloride |
Pubchem ID | 12456 |
KEGG ID | C12679 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antifungal |
Drug Like Properties | No |
Molecular Weight | 371.81 |
Exact mass | 371.092436 |
Molecular formula | C20H18ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-] |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1489 |
Name | Berberine chloride |
Pubchem ID | 12456 |
KEGG ID | C12679 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antidiarrheal |
Drug Like Properties | No |
Molecular Weight | 371.81 |
Exact mass | 371.092436 |
Molecular formula | C20H18ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-] |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2283 |
Name | Hydrastine |
Pubchem ID | 442247 |
KEGG ID | C09462 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Haemostatic |
Drug Like Properties | Yes |
Molecular Weight | 383.39 |
Exact mass | 383.136887 |
Molecular formula | C21H21NO6 |
XlogP | 2.7 |
Topological Polar Surface Area | 66.5 |
H-Bond Donor | 0 |
H-Bond Acceptor | 7 |
Rotational Bond Count | 3 |
IUPAC Name | (3R)-6,7-dimethoxy-3-[(5R)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-3H-2-benzofuran-1-one |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C(=C(C=C5)OC)OC)C(=O)O4)OCO3 |
Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@@H]1[C@H]4C5=C(C(=C(C=C5)OC)OC)C(=O)O4)OCO3 |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2286 |
Name | Hydrastine |
Pubchem ID | 442247 |
KEGG ID | C09462 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Antiseptic |
Drug Like Properties | Yes |
Molecular Weight | 383.39 |
Exact mass | 383.136887 |
Molecular formula | C21H21NO6 |
XlogP | 2.7 |
Topological Polar Surface Area | 66.5 |
H-Bond Donor | 0 |
H-Bond Acceptor | 7 |
Rotational Bond Count | 3 |
IUPAC Name | (3R)-6,7-dimethoxy-3-[(5R)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-3H-2-benzofuran-1-one |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C(=C(C=C5)OC)OC)C(=O)O4)OCO3 |
Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@@H]1[C@H]4C5=C(C(=C(C=C5)OC)OC)C(=O)O4)OCO3 |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2408 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |